C14H13F3N2O — CID 159859184
(5S)-5-ethyl-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 159859184) has the molecular formula C14H13F3N2O and a molecular weight of 282.27 g/mol. Its IUPAC name is (5S)-5-ethyl-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-ethyl-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 159859184 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (5S)-5-ethyl-1-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)CC[C@@H]2CC)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O/c1-3-9-5-7-13(20)19(9)10-4-6-12(18-2)11(8-10)14(15,16)17/h4,6,8-9H,3,5,7H2,1H3/t9-/m0/s1 |
| InChIKey | SFDLKVVPUNCDMP-VIFPVBQESA-N |
| XLogP | 4.16 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|