C27H31F3N4O2S — CID 59296370
3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[4-[[methyl(propan-2-yl)amino]methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 59296370) has the molecular formula C27H31F3N4O2S and a molecular weight of 532.63 g/mol. Its IUPAC name is 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[4-[[methyl(propan-2-yl)amino]methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[4-[[methyl(propan-2-yl)amino]methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59296370 |
| Molecular Formula | C27H31F3N4O2S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[4-[[methyl(propan-2-yl)amino]methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(CN(C)C(C)C)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C27H31F3N4O2S/c1-18(2)32(6)17-19-8-11-21(12-9-19)36-15-7-14-33-25(37)34(24(35)26(33,3)4)20-10-13-23(31-5)22(16-20)27(28,29)30/h8-13,16,18H,7,14-15,17H2,1-4,6H3 |
| InChIKey | ZVJBWWJDKXEGME-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|