C26H24ClN4O3S+ — CID 123971107
3-(3-chloro-4-isocyanophenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)phenoxy]propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 123971107) has the molecular formula C26H24ClN4O3S+ and a molecular weight of 508.02 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyanophenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)phenoxy]propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)phenoxy]propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 123971107 |
| Molecular Formula | C26H24ClN4O3S+ |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)phenoxy]propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(-c4cc[n+](O)cc4)cc3)C2=S)cc1Cl |
| InChI | InChI=1S/C26H24ClN4O3S/c1-26(2)24(32)31(20-7-10-23(28-3)22(27)17-20)25(35)30(26)13-4-16-34-21-8-5-18(6-9-21)19-11-14-29(33)15-12-19/h5-12,14-15,17,33H,4,13,16H2,1-2H3/q+1 |
| InChIKey | WOCWNQUVSUUWHX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|