C28H25ClF3N4O4+ — CID 123467294
3-(3-chloro-4-isocyano-2-methylphenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)-3-(trifluoromethyl)phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 123467294) has the molecular formula C28H25ClF3N4O4+ and a molecular weight of 573.98 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyano-2-methylphenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)-3-(trifluoromethyl)phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(3-chloro-4-isocyano-2-methylphenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)-3-(trifluoromethyl)phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123467294 |
| Molecular Formula | C28H25ClF3N4O4+ |
| Molecular Weight | 573.98 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 3-(3-chloro-4-isocyano-2-methylphenyl)-1-[3-[4-(1-hydroxypyridin-1-ium-4-yl)-3-(trifluoromethyl)phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)N(CCCOc3ccc(-c4cc[n+](O)cc4)c(C(F)(F)F)c3)C(C)(C)C2=O)c(C)c1Cl |
| InChI | InChI=1S/C28H25ClF3N4O4/c1-17-23(9-8-22(33-4)24(17)29)36-25(37)27(2,3)35(26(36)38)12-5-15-40-19-6-7-20(21(16-19)28(30,31)32)18-10-13-34(39)14-11-18/h6-11,13-14,16,39H,5,12,15H2,1-3H3/q+1 |
| InChIKey | IIOKJQLBSWAIHM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.98 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|