C15H17F3N2O3 — CID 143036897
1-(2-hydroxyethyl)-5,5-dimethyl-3-[4-methyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 143036897) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-5,5-dimethyl-3-[4-methyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-(2-hydroxyethyl)-5,5-dimethyl-3-[4-methyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143036897 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-5,5-dimethyl-3-[4-methyl-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N(CCO)C(C)(C)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3/c1-9-4-5-10(8-11(9)15(16,17)18)20-12(22)14(2,3)19(6-7-21)13(20)23/h4-5,8,21H,6-7H2,1-3H3 |
| InChIKey | SCEYOYNSQNCZOI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|