C18H21F3IN3O6 — CID 66751104
1-[2-[2-(2-iodoethoxy)ethoxy]ethyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 66751104) has the molecular formula C18H21F3IN3O6 and a molecular weight of 559.28 g/mol. Its IUPAC name is 1-[2-[2-(2-iodoethoxy)ethoxy]ethyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-[2-(2-iodoethoxy)ethoxy]ethyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66751104 |
| Molecular Formula | C18H21F3IN3O6 |
| Molecular Weight | 559.28 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 1-[2-[2-(2-iodoethoxy)ethoxy]ethyl]-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=O)N1CCOCCOCCI |
| InChI | InChI=1S/C18H21F3IN3O6/c1-17(2)15(26)24(16(27)23(17)6-8-31-10-9-30-7-5-22)12-3-4-14(25(28)29)13(11-12)18(19,20)21/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | FZTZQEJXPMLXHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|