C17H16F3N3O4 — CID 22116931
ethyl 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetate (PubChem CID 22116931) has the molecular formula C17H16F3N3O4 and a molecular weight of 383.33 g/mol. Its IUPAC name is ethyl 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 22116931 |
| Molecular Formula | C17H16F3N3O4 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | ethyl 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C17H16F3N3O4/c1-4-27-13(24)9-22-15(26)23(14(25)16(22,2)3)11-6-5-10(8-21)12(7-11)17(18,19)20/h5-7H,4,9H2,1-3H3 |
| InChIKey | BBVDAWUXGFWJGQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|