C22H21BrF3N5O2 — CID 118211098
4-[3-[(Z)-4-(4-bromo-3,5-dimethylpyrazol-1-yl)but-2-enyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 118211098) has the molecular formula C22H21BrF3N5O2 and a molecular weight of 524.34 g/mol. Its IUPAC name is 4-[3-[(Z)-4-(4-bromo-3,5-dimethylpyrazol-1-yl)but-2-enyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[(Z)-4-(4-bromo-3,5-dimethylpyrazol-1-yl)but-2-enyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 118211098 |
| Molecular Formula | C22H21BrF3N5O2 |
| Molecular Weight | 524.34 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 4-[3-[(Z)-4-(4-bromo-3,5-dimethylpyrazol-1-yl)but-2-enyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1nn(C/C=C\CN2C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)c(C)c1Br |
| InChI | InChI=1S/C22H21BrF3N5O2/c1-13-18(23)14(2)30(28-13)10-6-5-9-29-20(33)31(19(32)21(29,3)4)16-8-7-15(12-27)17(11-16)22(24,25)26/h5-8,11H,9-10H2,1-4H3/b6-5- |
| InChIKey | ICAGXHHVLITHBS-WAYWQWQTSA-N |
| XLogP | 4.96 |
| TPSA | 82.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|