C26H23F3N4O3 — CID 118182483
4-[4,4-dimethyl-3-[3-(2-methylquinolin-6-yl)oxypropyl]-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 118182483) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is 4-[4,4-dimethyl-3-[3-(2-methylquinolin-6-yl)oxypropyl]-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-3-[3-(2-methylquinolin-6-yl)oxypropyl]-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 118182483 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[4,4-dimethyl-3-[3-(2-methylquinolin-6-yl)oxypropyl]-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1ccc2cc(OCCCN3C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)C3(C)C)ccc2n1 |
| InChI | InChI=1S/C26H23F3N4O3/c1-16-5-6-17-13-20(9-10-22(17)31-16)36-12-4-11-32-24(35)33(23(34)25(32,2)3)19-8-7-18(15-30)21(14-19)26(27,28)29/h5-10,13-14H,4,11-12H2,1-3H3 |
| InChIKey | JMBPTPJWWQHHMP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 86.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|