C23H26F3N3O5 — CID 15838447
4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]butyl cyclopentyl carbonate (PubChem CID 15838447) has the molecular formula C23H26F3N3O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]butyl cyclopentyl carbonate.
| Compound Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]butyl cyclopentyl carbonate |
|---|---|
| PubChem CID | 15838447 |
| Molecular Formula | C23H26F3N3O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]butyl cyclopentyl carbonate |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CCCCOC(=O)OC1CCCC1 |
| InChI | InChI=1S/C23H26F3N3O5/c1-22(2)19(30)29(16-10-9-15(14-27)18(13-16)23(24,25)26)20(31)28(22)11-5-6-12-33-21(32)34-17-7-3-4-8-17/h9-10,13,17H,3-8,11-12H2,1-2H3 |
| InChIKey | CVGPKZGBTPIXJT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|