C36H48F3N3O7 — CID 147738128
4-[3-[7-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]-4-oxoheptyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 147738128) has the molecular formula C36H48F3N3O7 and a molecular weight of 691.79 g/mol. Its IUPAC name is 4-[3-[7-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]-4-oxoheptyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[7-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]-4-oxoheptyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 147738128 |
| Molecular Formula | C36H48F3N3O7 |
| Molecular Weight | 691.79 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 4-[3-[7-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]-4-oxoheptyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CCCC(=O)CCCOCCOCCOCCOC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H48F3N3O7/c1-34(2)32(44)42(29-8-7-28(24-40)31(20-29)36(37,38)39)33(45)41(34)9-3-5-30(43)6-4-10-46-11-12-47-13-14-48-15-16-49-35-21-25-17-26(22-35)19-27(18-25)23-35/h7-8,20,25-27H,3-6,9-19,21-23H2,1-2H3 |
| InChIKey | GZTYSLSGTHQNNM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 118.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|