C32H37F3N6O5 — CID 162662227
2-[2-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]triazol-1-yl]ethoxy]ethyl 2-(1-adamantyl)acetate (PubChem CID 162662227) has the molecular formula C32H37F3N6O5 and a molecular weight of 642.68 g/mol. Its IUPAC name is 2-[2-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]triazol-1-yl]ethoxy]ethyl 2-(1-adamantyl)acetate.
| Compound Name | 2-[2-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]triazol-1-yl]ethoxy]ethyl 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 162662227 |
| Molecular Formula | C32H37F3N6O5 |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[2-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]triazol-1-yl]ethoxy]ethyl 2-(1-adamantyl)acetate |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1Cc1cn(CCOCCOC(=O)CC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C32H37F3N6O5/c1-30(2)28(43)41(25-4-3-23(17-36)26(12-25)32(33,34)35)29(44)40(30)19-24-18-39(38-37-24)5-6-45-7-8-46-27(42)16-31-13-20-9-21(14-31)11-22(10-20)15-31/h3-4,12,18,20-22H,5-11,13-16,19H2,1-2H3 |
| InChIKey | JPOKUOTYSPLHSV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 130.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|