C30H32F3N7O4 — CID 56961887
8-[4-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]phenyl]triazol-1-yl]-N-hydroxyoctanamide (PubChem CID 56961887) has the molecular formula C30H32F3N7O4 and a molecular weight of 611.63 g/mol. Its IUPAC name is 8-[4-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]phenyl]triazol-1-yl]-N-hydroxyoctanamide.
| Compound Name | 8-[4-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]phenyl]triazol-1-yl]-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 56961887 |
| Molecular Formula | C30H32F3N7O4 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 8-[4-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]phenyl]triazol-1-yl]-N-hydroxyoctanamide |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1Cc1ccc(-c2cn(CCCCCCCC(=O)NO)nn2)cc1 |
| InChI | InChI=1S/C30H32F3N7O4/c1-29(2)27(42)40(23-14-13-22(17-34)24(16-23)30(31,32)33)28(43)39(29)18-20-9-11-21(12-10-20)25-19-38(37-35-25)15-7-5-3-4-6-8-26(41)36-44/h9-14,16,19,44H,3-8,15,18H2,1-2H3,(H,36,41) |
| InChIKey | ZUMBXUKAGWHZCR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|