C27H24F4N8O3S — CID 177295497
5-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxypentanamide (PubChem CID 177295497) has the molecular formula C27H24F4N8O3S and a molecular weight of 616.60 g/mol. Its IUPAC name is 5-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 177295497 |
| Molecular Formula | C27H24F4N8O3S |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 5-[4-[4-[[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]methyl]-3-fluorophenyl]triazol-1-yl]-N-hydroxypentanamide |
| SMILES | N#Cc1ncc(N2C(=O)C3(CCC3)N(Cc3ccc(-c4cn(CCCCC(=O)NO)nn4)cc3F)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C27H24F4N8O3S/c28-20-10-16(22-15-37(36-34-22)9-2-1-4-23(40)35-42)5-6-17(20)14-38-25(43)39(24(41)26(38)7-3-8-26)18-11-19(27(29,30)31)21(12-32)33-13-18/h5-6,10-11,13,15,42H,1-4,7-9,14H2,(H,35,40) |
| InChIKey | RGDSMMXWJJQHKQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|