About Apalutamide-d4
Apalutamide-d4 (PubChem CID 86342611) has the molecular formula C21H15F4N5O2S
and a molecular weight of 481.50 g/mol. Its IUPAC name is 4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-1,1,3,3-tetradeuterio-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-2-fluoro-N-methylbenzamide.
Molecular Properties
| Compound Name | Apalutamide-d4 |
| PubChem CID | 86342611 |
| Molecular Formula | C21H15F4N5O2S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-1,1,3,3-tetradeuterio-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-2-fluoro-N-methylbenzamide |
| SMILES | [2H]C1(CC(C12C(=O)N(C(=S)N2C3=CC(=C(C=C3)C(=O)NC)F)C4=CC(=C(N=C4)C#N)C(F)(F)F)([2H])[2H])[2H] |
| InChI | InChI=1S/C21H15F4N5O2S/c1-27-17(31)13-4-3-11(8-15(13)22)30-19(33)29(18(32)20(30)5-2-6-20)12-7-14(21(23,24)25)16(9-26)28-10-12/h3-4,7-8,10H,2,5-6H2,1H3,(H,27,31)/i5D2,6D2 |
| InChIKey | HJBWBFZLDZWPHF-NZLXMSDQSA-N |
| XLogP | 3.00 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | 886 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze Apalutamide-d4 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Apalutamide-d4?
The IUPAC name of Apalutamide-d4 (CID 86342611) is 4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-1,1,3,3-tetradeuterio-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-2-fluoro-N-methylbenzamide.
What is the SMILES notation for Apalutamide-d4?
The canonical SMILES for Apalutamide-d4 is [2H]C1(CC(C12C(=O)N(C(=S)N2C3=CC(=C(C=C3)C(=O)NC)F)C4=CC(=C(N=C4)C#N)C(F)(F)F)([2H])[2H])[2H].
What is the InChIKey of Apalutamide-d4?
The InChIKey is HJBWBFZLDZWPHF-NZLXMSDQSA-N. The full InChI is InChI=1S/C21H15F4N5O2S/c1-27-17(31)13-4-3-11(8-15(13)22)30-19(33)29(18(32)20(30)5-2-6-20)12-7-14(21(23,24)25)16(9-26)28-10-12/h3-4,7-8,10H,2,5-6H2,1H3,(H,27,31)/i5D2,6D2.
What are the key properties of Apalutamide-d4?
Apalutamide-d4 has a molecular weight of 481.50 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for Apalutamide-d4 is sourced from PubChem (CID 86342611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).