C24H24F3N3O3 — CID 22116909
4-[4,4-dimethyl-2,5-dioxo-3-(4-phenylmethoxybutyl)imidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22116909) has the molecular formula C24H24F3N3O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2,5-dioxo-3-(4-phenylmethoxybutyl)imidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-2,5-dioxo-3-(4-phenylmethoxybutyl)imidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22116909 |
| Molecular Formula | C24H24F3N3O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-[4,4-dimethyl-2,5-dioxo-3-(4-phenylmethoxybutyl)imidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CCCCOCc1ccccc1 |
| InChI | InChI=1S/C24H24F3N3O3/c1-23(2)21(31)30(19-11-10-18(15-28)20(14-19)24(25,26)27)22(32)29(23)12-6-7-13-33-16-17-8-4-3-5-9-17/h3-5,8-11,14H,6-7,12-13,16H2,1-2H3 |
| InChIKey | PQMMSTWMTZNGBP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|