C14H11F4N3O2 — CID 162657022
2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetonitrile (PubChem CID 162657022) has the molecular formula C14H11F4N3O2 and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetonitrile.
| Compound Name | 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 162657022 |
| Molecular Formula | C14H11F4N3O2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]acetonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(F)c(C(F)(F)F)c2)C(=O)N1CC#N |
| InChI | InChI=1S/C14H11F4N3O2/c1-13(2)11(22)21(12(23)20(13)6-5-19)8-3-4-10(15)9(7-8)14(16,17)18/h3-4,7H,6H2,1-2H3 |
| InChIKey | QZFVGPYRMVLLFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|