C18H13F3IN3O4S — CID 118886773
[4-[5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl] hypoiodite (PubChem CID 118886773) has the molecular formula C18H13F3IN3O4S and a molecular weight of 551.28 g/mol. Its IUPAC name is [4-[5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl] hypoiodite.
| Compound Name | [4-[5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 118886773 |
| Molecular Formula | C18H13F3IN3O4S |
| Molecular Weight | 551.28 g/mol |
| Exact Mass | 550.96 |
| IUPAC Name | [4-[5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl] hypoiodite |
| SMILES | CC1(C)C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=S)N1c1ccc(OI)cc1 |
| InChI | InChI=1S/C18H13F3IN3O4S/c1-17(2)15(26)23(16(30)24(17)10-3-6-12(29-22)7-4-10)11-5-8-14(25(27)28)13(9-11)18(19,20)21/h3-9H,1-2H3 |
| InChIKey | VCUYNUDZQSYDAU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|