C17H19F3IN3O4 — CID 46945768
1-(5-iodopentyl)-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 46945768) has the molecular formula C17H19F3IN3O4 and a molecular weight of 513.25 g/mol. Its IUPAC name is 1-(5-iodopentyl)-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-(5-iodopentyl)-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46945768 |
| Molecular Formula | C17H19F3IN3O4 |
| Molecular Weight | 513.25 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 1-(5-iodopentyl)-5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=O)N1CCCCCI |
| InChI | InChI=1S/C17H19F3IN3O4/c1-16(2)14(25)23(15(26)22(16)9-5-3-4-8-21)11-6-7-13(24(27)28)12(10-11)17(18,19)20/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | UFIVTCQYGGXCFF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|