C25H33F6N3O6S — CID 87172702
5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-1-oxido-1-[9-(4,4,4-trifluorobutylsulfinyl)nonyl]imidazolidin-1-ium-2,4-dione (PubChem CID 87172702) has the molecular formula C25H33F6N3O6S and a molecular weight of 617.61 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-1-oxido-1-[9-(4,4,4-trifluorobutylsulfinyl)nonyl]imidazolidin-1-ium-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-1-oxido-1-[9-(4,4,4-trifluorobutylsulfinyl)nonyl]imidazolidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 87172702 |
| Molecular Formula | C25H33F6N3O6S |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-1-oxido-1-[9-(4,4,4-trifluorobutylsulfinyl)nonyl]imidazolidin-1-ium-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=O)[N+]1([O-])CCCCCCCCCS(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C25H33F6N3O6S/c1-23(2)21(35)32(18-11-12-20(33(37)38)19(17-18)25(29,30)31)22(36)34(23,39)14-8-6-4-3-5-7-9-15-41(40)16-10-13-24(26,27)28/h11-12,17H,3-10,13-16H2,1-2H3 |
| InChIKey | RUULJEFUKBSVMW-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|