About azane;4-nitro-3-(trifluoromethyl)phenol
azane;4-nitro-3-(trifluoromethyl)phenol (PubChem CID 171929211) has the molecular formula C7H7F3N2O3
and a molecular weight of 224.14 g/mol. Its IUPAC name is azane;4-nitro-3-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | azane;4-nitro-3-(trifluoromethyl)phenol |
| PubChem CID | 171929211 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | azane;4-nitro-3-(trifluoromethyl)phenol |
| SMILES | N.O=[N+]([O-])c1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO3.H3N/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14;/h1-3,12H;1H3 |
| InChIKey | DLPUJJFDDBIRIY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;4-nitro-3-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-nitro-3-(trifluoromethyl)phenol?
The IUPAC name of azane;4-nitro-3-(trifluoromethyl)phenol (CID 171929211) is azane;4-nitro-3-(trifluoromethyl)phenol.
What is the SMILES notation for azane;4-nitro-3-(trifluoromethyl)phenol?
The canonical SMILES for azane;4-nitro-3-(trifluoromethyl)phenol is N.O=[N+]([O-])c1ccc(O)cc1C(F)(F)F.
What is the InChIKey of azane;4-nitro-3-(trifluoromethyl)phenol?
The InChIKey is DLPUJJFDDBIRIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO3.H3N/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14;/h1-3,12H;1H3.
What are the key properties of azane;4-nitro-3-(trifluoromethyl)phenol?
azane;4-nitro-3-(trifluoromethyl)phenol has a molecular weight of 224.14 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-nitro-3-(trifluoromethyl)phenol is sourced from PubChem (CID 171929211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).