C13H6Cl2F3NO2 — CID 134623765
4-(3,5-dichlorophenyl)-1-nitro-2-(trifluoromethyl)benzene (PubChem CID 134623765) has the molecular formula C13H6Cl2F3NO2 and a molecular weight of 336.10 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-1-nitro-2-(trifluoromethyl)benzene.
| Compound Name | 4-(3,5-dichlorophenyl)-1-nitro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134623765 |
| Molecular Formula | C13H6Cl2F3NO2 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-1-nitro-2-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(Cl)cc(Cl)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H6Cl2F3NO2/c14-9-3-8(4-10(15)6-9)7-1-2-12(19(20)21)11(5-7)13(16,17)18/h1-6H |
| InChIKey | ZROVHZIQPWQXBD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|