C13H3F8NO2 — CID 118812925
1,2,3,4,5-pentafluoro-6-[3-nitro-4-(trifluoromethyl)phenyl]benzene (PubChem CID 118812925) has the molecular formula C13H3F8NO2 and a molecular weight of 357.16 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[3-nitro-4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[3-nitro-4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 118812925 |
| Molecular Formula | C13H3F8NO2 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[3-nitro-4-(trifluoromethyl)phenyl]benzene |
| SMILES | O=[N+]([O-])c1cc(-c2c(F)c(F)c(F)c(F)c2F)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H3F8NO2/c14-8-7(9(15)11(17)12(18)10(8)16)4-1-2-5(13(19,20)21)6(3-4)22(23)24/h1-3H |
| InChIKey | NFDNIBIAOFGPBJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|