C13H6F4N2O4 — CID 174425918
2-fluoro-1,3-dinitro-5-[2-(trifluoromethyl)phenyl]benzene (PubChem CID 174425918) has the molecular formula C13H6F4N2O4 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-fluoro-1,3-dinitro-5-[2-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2-fluoro-1,3-dinitro-5-[2-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 174425918 |
| Molecular Formula | C13H6F4N2O4 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-fluoro-1,3-dinitro-5-[2-(trifluoromethyl)phenyl]benzene |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2C(F)(F)F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H6F4N2O4/c14-12-10(18(20)21)5-7(6-11(12)19(22)23)8-3-1-2-4-9(8)13(15,16)17/h1-6H |
| InChIKey | ZASLGMXEWPMKTJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|