C18H16F6N2O7 — CID 87525679
4-(1-methoxyethoxymethyl)-1-nitro-2-(trifluoromethyl)benzene;4-nitro-3-(trifluoromethyl)phenol (PubChem CID 87525679) has the molecular formula C18H16F6N2O7 and a molecular weight of 486.32 g/mol. Its IUPAC name is 4-(1-methoxyethoxymethyl)-1-nitro-2-(trifluoromethyl)benzene;4-nitro-3-(trifluoromethyl)phenol.
| Compound Name | 4-(1-methoxyethoxymethyl)-1-nitro-2-(trifluoromethyl)benzene;4-nitro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 87525679 |
| Molecular Formula | C18H16F6N2O7 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 4-(1-methoxyethoxymethyl)-1-nitro-2-(trifluoromethyl)benzene;4-nitro-3-(trifluoromethyl)phenol |
| SMILES | COC(C)OCc1ccc([N+](=O)[O-])c(C(F)(F)F)c1.O=[N+]([O-])c1ccc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO4.C7H4F3NO3/c1-7(18-2)19-6-8-3-4-10(15(16)17)9(5-8)11(12,13)14;8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h3-5,7H,6H2,1-2H3;1-3,12H |
| InChIKey | PTQIRMDPPRLVKJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|