C11H11F3N2O4 — CID 171238295
methyl (2S)-2-amino-3-[4-nitro-3-(trifluoromethyl)phenyl]propanoate (PubChem CID 171238295) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-nitro-3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[4-nitro-3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171238295 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-nitro-3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O4/c1-20-10(17)8(15)5-6-2-3-9(16(18)19)7(4-6)11(12,13)14/h2-4,8H,5,15H2,1H3/t8-/m0/s1 |
| InChIKey | RYQVQWGFISGRLS-QMMMGPOBSA-N |
| XLogP | 1.66 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|