C8H4F6N2O2 — CID 121234795
4-nitro-2,5-bis(trifluoromethyl)aniline (PubChem CID 121234795) has the molecular formula C8H4F6N2O2 and a molecular weight of 274.12 g/mol. Its IUPAC name is 4-nitro-2,5-bis(trifluoromethyl)aniline.
| Compound Name | 4-nitro-2,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 121234795 |
| Molecular Formula | C8H4F6N2O2 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-nitro-2,5-bis(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6N2O2/c9-7(10,11)3-2-6(16(17)18)4(1-5(3)15)8(12,13)14/h1-2H,15H2 |
| InChIKey | UEVDPILIPKKGSU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|