About 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline
4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline (PubChem CID 160819581) has the molecular formula C17H20F3N3O2
and a molecular weight of 355.36 g/mol. Its IUPAC name is 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline |
| PubChem CID | 160819581 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)c1ccc(N)cc1.Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H15N.C7H5F3N2O2/c1-10(2,3)8-4-6-9(11)7-5-8;8-7(9,10)5-3-4(11)1-2-6(5)12(13)14/h4-7H,11H2,1-3H3;1-3H,11H2 |
| InChIKey | SFIXRGBNOLUPQT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline?
The IUPAC name of 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline (CID 160819581) is 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline.
What is the SMILES notation for 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline?
The canonical SMILES for 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline is CC(C)(C)c1ccc(N)cc1.Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1.
What is the InChIKey of 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline?
The InChIKey is SFIXRGBNOLUPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C7H5F3N2O2/c1-10(2,3)8-4-6-9(11)7-5-8;8-7(9,10)5-3-4(11)1-2-6(5)12(13)14/h4-7H,11H2,1-3H3;1-3H,11H2.
What are the key properties of 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline?
4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline has a molecular weight of 355.36 g/mol, XLogP of 4.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylaniline;4-nitro-3-(trifluoromethyl)aniline is sourced from PubChem (CID 160819581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).