C14H10Br2Cl2F6N4O2Sn — CID 161112534
4-bromo-2-nitro-5-(trifluoromethyl)aniline;4-bromo-5-(trifluoromethyl)benzene-1,2-diamine;dichlorotin (PubChem CID 161112534) has the molecular formula C14H10Br2Cl2F6N4O2Sn and a molecular weight of 729.67 g/mol. Its IUPAC name is 4-bromo-2-nitro-5-(trifluoromethyl)aniline;4-bromo-5-(trifluoromethyl)benzene-1,2-diamine;dichlorotin.
| Compound Name | 4-bromo-2-nitro-5-(trifluoromethyl)aniline;4-bromo-5-(trifluoromethyl)benzene-1,2-diamine;dichlorotin |
|---|---|
| PubChem CID | 161112534 |
| Molecular Formula | C14H10Br2Cl2F6N4O2Sn |
| Molecular Weight | 729.67 g/mol |
| Exact Mass | 727.75 |
| IUPAC Name | 4-bromo-2-nitro-5-(trifluoromethyl)aniline;4-bromo-5-(trifluoromethyl)benzene-1,2-diamine;dichlorotin |
| SMILES | Cl[Sn]Cl.Nc1cc(Br)c(C(F)(F)F)cc1N.Nc1cc(C(F)(F)F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4BrF3N2O2.C7H6BrF3N2.2ClH.Sn/c8-4-2-6(13(14)15)5(12)1-3(4)7(9,10)11;8-4-2-6(13)5(12)1-3(4)7(9,10)11;;;/h1-2H,12H2;1-2H,12-13H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | UJWQKUKTNGSWSY-UHFFFAOYSA-L |
| XLogP | 6.59 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|