C12H10F3N3O5 — CID 70384078
1-(hydroxymethyl)-5-methyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 70384078) has the molecular formula C12H10F3N3O5 and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-(hydroxymethyl)-5-methyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-(hydroxymethyl)-5-methyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70384078 |
| Molecular Formula | C12H10F3N3O5 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(hydroxymethyl)-5-methyl-3-[4-nitro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1C(=O)N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C(=O)N1CO |
| InChI | InChI=1S/C12H10F3N3O5/c1-6-10(20)17(11(21)16(6)5-19)7-2-3-9(18(22)23)8(4-7)12(13,14)15/h2-4,6,19H,5H2,1H3 |
| InChIKey | SQJHXZJDLCIUFK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|