C16H16F3N3O4 — CID 10309242
(2R,6R)-6-hydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one (PubChem CID 10309242) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is (2R,6R)-6-hydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one.
| Compound Name | (2R,6R)-6-hydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one |
|---|---|
| PubChem CID | 10309242 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2R,6R)-6-hydroxy-4-[4-nitro-3-(trifluoromethyl)phenyl]-3,4-diazatricyclo[5.2.2.02,6]undecan-5-one |
| SMILES | O=C1N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)N[C@@H]2C3CCC(CC3)[C@]12O |
| InChI | InChI=1S/C16H16F3N3O4/c17-16(18,19)11-7-10(5-6-12(11)22(25)26)21-14(23)15(24)9-3-1-8(2-4-9)13(15)20-21/h5-9,13,20,24H,1-4H2/t8?,9?,13-,15-/m1/s1 |
| InChIKey | VUBVNMRORCKOHG-SPMUZYDJSA-N |
| XLogP | 2.38 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|