C12H10BrF5N2O2 — CID 59410064
(2S)-2-(bromomethyl)-4,4-difluoro-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 59410064) has the molecular formula C12H10BrF5N2O2 and a molecular weight of 389.12 g/mol. Its IUPAC name is (2S)-2-(bromomethyl)-4,4-difluoro-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | (2S)-2-(bromomethyl)-4,4-difluoro-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 59410064 |
| Molecular Formula | C12H10BrF5N2O2 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | (2S)-2-(bromomethyl)-4,4-difluoro-1-[4-nitro-3-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(N2CC(F)(F)C[C@H]2CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10BrF5N2O2/c13-5-8-4-11(14,15)6-19(8)7-1-2-10(20(21)22)9(3-7)12(16,17)18/h1-3,8H,4-6H2/t8-/m0/s1 |
| InChIKey | LPDVOVVHXBMUJK-QMMMGPOBSA-N |
| XLogP | 4.22 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|