C12H8F6N2O5 — CID 126600567
(2R,5S)-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxylic acid (PubChem CID 126600567) has the molecular formula C12H8F6N2O5 and a molecular weight of 374.19 g/mol. Its IUPAC name is (2R,5S)-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | (2R,5S)-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 126600567 |
| Molecular Formula | C12H8F6N2O5 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (2R,5S)-3-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C12H8F6N2O5/c13-11(14,15)6-3-5(1-2-7(6)20(23)24)19-4-8(9(21)22)25-10(19)12(16,17)18/h1-3,8,10H,4H2,(H,21,22)/t8-,10+/m0/s1 |
| InChIKey | ZWZPDCKXXAQXHL-WCBMZHEXSA-N |
| XLogP | 2.79 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|