C20H12F6N4O4 — CID 126600439
4-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]methoxy]-3-nitrobenzonitrile (PubChem CID 126600439) has the molecular formula C20H12F6N4O4 and a molecular weight of 486.33 g/mol. Its IUPAC name is 4-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]methoxy]-3-nitrobenzonitrile.
| Compound Name | 4-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]methoxy]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 126600439 |
| Molecular Formula | C20H12F6N4O4 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 4-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]methoxy]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(OC[C@@H]2CN(c3ccc(C#N)c(C(F)(F)F)c3)[C@@H](C(F)(F)F)O2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12F6N4O4/c21-19(22,23)15-6-13(3-2-12(15)8-28)29-9-14(34-18(29)20(24,25)26)10-33-17-4-1-11(7-27)5-16(17)30(31)32/h1-6,14,18H,9-10H2/t14-,18+/m0/s1 |
| InChIKey | WFZTZHZTCAZWKD-KBXCAEBGSA-N |
| XLogP | 4.53 |
| TPSA | 112.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|