C19H15ClF3N3O4 — CID 126611000
4-[(2R,5S)-5-[(2-chloro-4-nitrophenoxy)methyl]-2-methyl-1,3-oxazolidin-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 126611000) has the molecular formula C19H15ClF3N3O4 and a molecular weight of 441.79 g/mol. Its IUPAC name is 4-[(2R,5S)-5-[(2-chloro-4-nitrophenoxy)methyl]-2-methyl-1,3-oxazolidin-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(2R,5S)-5-[(2-chloro-4-nitrophenoxy)methyl]-2-methyl-1,3-oxazolidin-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 126611000 |
| Molecular Formula | C19H15ClF3N3O4 |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-[(2R,5S)-5-[(2-chloro-4-nitrophenoxy)methyl]-2-methyl-1,3-oxazolidin-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@H]1O[C@H](COc2ccc([N+](=O)[O-])cc2Cl)CN1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15ClF3N3O4/c1-11-25(13-3-2-12(8-24)16(6-13)19(21,22)23)9-15(30-11)10-29-18-5-4-14(26(27)28)7-17(18)20/h2-7,11,15H,9-10H2,1H3/t11-,15+/m1/s1 |
| InChIKey | BHFFMVPTXBTSMX-ABAIWWIYSA-N |
| XLogP | 4.77 |
| TPSA | 88.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|