C18H9F6N5O3 — CID 122191353
4-[4-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]triazol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 122191353) has the molecular formula C18H9F6N5O3 and a molecular weight of 457.29 g/mol. Its IUPAC name is 4-[4-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]triazol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]triazol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 122191353 |
| Molecular Formula | C18H9F6N5O3 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 4-[4-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]triazol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(-n2cc(COc3ccc([N+](=O)[O-])cc3C(F)(F)F)nn2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H9F6N5O3/c19-17(20,21)14-5-12(2-1-10(14)7-25)28-8-11(26-27-28)9-32-16-4-3-13(29(30)31)6-15(16)18(22,23)24/h1-6,8H,9H2 |
| InChIKey | ZDTSWELNOMCMMY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|