C22H19F3N4O3 — CID 149183793
N-[2-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidin-5-yl]methoxy]-5-isocyanophenyl]acetamide (PubChem CID 149183793) has the molecular formula C22H19F3N4O3 and a molecular weight of 444.41 g/mol. Its IUPAC name is N-[2-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidin-5-yl]methoxy]-5-isocyanophenyl]acetamide.
| Compound Name | N-[2-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidin-5-yl]methoxy]-5-isocyanophenyl]acetamide |
|---|---|
| PubChem CID | 149183793 |
| Molecular Formula | C22H19F3N4O3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[2-[[(2R,5S)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidin-5-yl]methoxy]-5-isocyanophenyl]acetamide |
| SMILES | [C-]#[N+]c1ccc(OC[C@@H]2CN(c3ccc(C#N)c(C(F)(F)F)c3)[C@@H](C)O2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C22H19F3N4O3/c1-13(30)28-20-8-16(27-3)5-7-21(20)31-12-18-11-29(14(2)32-18)17-6-4-15(10-26)19(9-17)22(23,24)25/h4-9,14,18H,11-12H2,1-2H3,(H,28,30)/t14-,18+/m1/s1 |
| InChIKey | XBMBPKQRSVKTJI-KDOFPFPSSA-N |
| XLogP | 4.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|