C19H17F3N4O2 — CID 126611073
(2R,5S)-N-(4-aminophenyl)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidine-5-carboxamide (PubChem CID 126611073) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is (2R,5S)-N-(4-aminophenyl)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidine-5-carboxamide.
| Compound Name | (2R,5S)-N-(4-aminophenyl)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 126611073 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (2R,5S)-N-(4-aminophenyl)-3-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-1,3-oxazolidine-5-carboxamide |
| SMILES | C[C@H]1O[C@H](C(=O)Nc2ccc(N)cc2)CN1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-11-26(15-7-2-12(9-23)16(8-15)19(20,21)22)10-17(28-11)18(27)25-14-5-3-13(24)4-6-14/h2-8,11,17H,10,24H2,1H3,(H,25,27)/t11-,17+/m1/s1 |
| InChIKey | GEICHYHRZDSGDT-DIFFPNOSSA-N |
| XLogP | 3.35 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|