C21H22F3N5O — CID 69107964
(2S,5R)-N-(4-aminophenyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide (PubChem CID 69107964) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is (2S,5R)-N-(4-aminophenyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide.
| Compound Name | (2S,5R)-N-(4-aminophenyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 69107964 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (2S,5R)-N-(4-aminophenyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2ccc(N)cc2)[C@@H](C)CN1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N5O/c1-13-12-29(20(30)27-17-6-4-16(26)5-7-17)14(2)11-28(13)18-8-3-15(10-25)19(9-18)21(22,23)24/h3-9,13-14H,11-12,26H2,1-2H3,(H,27,30)/t13-,14+/m1/s1 |
| InChIKey | LWHXSSODNNXQDZ-KGLIPLIRSA-N |
| XLogP | 4.29 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|