C17H18F3N3O — CID 139895087
4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 139895087) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 139895087 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2ccc(C#N)c(C(F)(F)F)c2)C[C@H]1C |
| InChI | InChI=1S/C17H18F3N3O/c1-4-16(24)23-10-11(2)22(9-12(23)3)14-6-5-13(8-21)15(7-14)17(18,19)20/h4-7,11-12H,1,9-10H2,2-3H3/t11-,12+/m0/s1 |
| InChIKey | SSBRDBGKHYBZCU-NWDGAFQWSA-N |
| XLogP | 3.19 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|