C18H14F3N5O4 — CID 126600302
(2R,5S)-N-(6-cyano-3-pyridinyl)-3-(3-methyl-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide (PubChem CID 126600302) has the molecular formula C18H14F3N5O4 and a molecular weight of 421.34 g/mol. Its IUPAC name is (2R,5S)-N-(6-cyano-3-pyridinyl)-3-(3-methyl-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide.
| Compound Name | (2R,5S)-N-(6-cyano-3-pyridinyl)-3-(3-methyl-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 126600302 |
| Molecular Formula | C18H14F3N5O4 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (2R,5S)-N-(6-cyano-3-pyridinyl)-3-(3-methyl-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
| SMILES | Cc1cc(N2C[C@@H](C(=O)Nc3ccc(C#N)nc3)O[C@@H]2C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14F3N5O4/c1-10-6-13(4-5-14(10)26(28)29)25-9-15(30-17(25)18(19,20)21)16(27)24-12-3-2-11(7-22)23-8-12/h2-6,8,15,17H,9H2,1H3,(H,24,27)/t15-,17+/m0/s1 |
| InChIKey | FAQGEWQWXFHEKY-DOTOQJQBSA-N |
| XLogP | 2.90 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|