C16H11Cl2F3N4O4 — CID 126600252
(2R,5S)-3-(3-chloro-4-nitrophenyl)-N-(6-chloro-3-pyridinyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide (PubChem CID 126600252) has the molecular formula C16H11Cl2F3N4O4 and a molecular weight of 451.19 g/mol. Its IUPAC name is (2R,5S)-3-(3-chloro-4-nitrophenyl)-N-(6-chloro-3-pyridinyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide.
| Compound Name | (2R,5S)-3-(3-chloro-4-nitrophenyl)-N-(6-chloro-3-pyridinyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 126600252 |
| Molecular Formula | C16H11Cl2F3N4O4 |
| Molecular Weight | 451.19 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | (2R,5S)-3-(3-chloro-4-nitrophenyl)-N-(6-chloro-3-pyridinyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)[C@@H]1CN(c2ccc([N+](=O)[O-])c(Cl)c2)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C16H11Cl2F3N4O4/c17-10-5-9(2-3-11(10)25(27)28)24-7-12(29-15(24)16(19,20)21)14(26)23-8-1-4-13(18)22-6-8/h1-6,12,15H,7H2,(H,23,26)/t12-,15+/m0/s1 |
| InChIKey | UXZNPQLMCGKHNR-SWLSCSKDSA-N |
| XLogP | 4.03 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|