C17H21ClN4O6 — CID 126611110
methyl 4-[(2R,5S)-3-(3-chloro-4-nitrophenyl)-2-methyl-1,3-oxazolidine-5-carbonyl]piperazine-1-carboxylate (PubChem CID 126611110) has the molecular formula C17H21ClN4O6 and a molecular weight of 412.83 g/mol. Its IUPAC name is methyl 4-[(2R,5S)-3-(3-chloro-4-nitrophenyl)-2-methyl-1,3-oxazolidine-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(2R,5S)-3-(3-chloro-4-nitrophenyl)-2-methyl-1,3-oxazolidine-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126611110 |
| Molecular Formula | C17H21ClN4O6 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 4-[(2R,5S)-3-(3-chloro-4-nitrophenyl)-2-methyl-1,3-oxazolidine-5-carbonyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)[C@@H]2CN(c3ccc([N+](=O)[O-])c(Cl)c3)[C@@H](C)O2)CC1 |
| InChI | InChI=1S/C17H21ClN4O6/c1-11-21(12-3-4-14(22(25)26)13(18)9-12)10-15(28-11)16(23)19-5-7-20(8-6-19)17(24)27-2/h3-4,9,11,15H,5-8,10H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | NTAIZMMKUVLHMP-ABAIWWIYSA-N |
| XLogP | 1.71 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|