C12H13ClN2O4 — CID 97329067
(3-chloro-4-nitrophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone (PubChem CID 97329067) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is (3-chloro-4-nitrophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone.
| Compound Name | (3-chloro-4-nitrophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 97329067 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (3-chloro-4-nitrophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc([N+](=O)[O-])c(Cl)c2)CCO1 |
| InChI | InChI=1S/C12H13ClN2O4/c1-8-7-14(4-5-19-8)12(16)9-2-3-11(15(17)18)10(13)6-9/h2-3,6,8H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | OSCGPNHFNQMVTG-MRVPVSSYSA-N |
| XLogP | 2.11 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|