C13H15ClN2O4 — CID 82781380
(3-chloro-4-nitrophenyl)-(2,2-dimethylmorpholin-4-yl)methanone (PubChem CID 82781380) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is (3-chloro-4-nitrophenyl)-(2,2-dimethylmorpholin-4-yl)methanone.
| Compound Name | (3-chloro-4-nitrophenyl)-(2,2-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 82781380 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (3-chloro-4-nitrophenyl)-(2,2-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc([N+](=O)[O-])c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H15ClN2O4/c1-13(2)8-15(5-6-20-13)12(17)9-3-4-11(16(18)19)10(14)7-9/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | RCQGNASDBPWZBW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|