C16H17ClN4O3 — CID 59654084
N-[5-[(2S)-1-(3-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-pyrrol-2-yl]acetamide (PubChem CID 59654084) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[5-[(2S)-1-(3-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-pyrrol-2-yl]acetamide.
| Compound Name | N-[5-[(2S)-1-(3-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-pyrrol-2-yl]acetamide |
|---|---|
| PubChem CID | 59654084 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[5-[(2S)-1-(3-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-pyrrol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@@H]2CCCN2c2ccc([N+](=O)[O-])c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-10(22)18-16-7-5-13(19-16)15-3-2-8-20(15)11-4-6-14(21(23)24)12(17)9-11/h4-7,9,15,19H,2-3,8H2,1H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | FHFCOHMOEJRSDR-HNNXBMFYSA-N |
| XLogP | 3.88 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|