C19H16ClF3N4O5 — CID 126600224
N-(4-acetamidophenyl)-3-(3-chloro-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide (PubChem CID 126600224) has the molecular formula C19H16ClF3N4O5 and a molecular weight of 472.81 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3-(3-chloro-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-3-(3-chloro-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 126600224 |
| Molecular Formula | C19H16ClF3N4O5 |
| Molecular Weight | 472.81 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-(4-acetamidophenyl)-3-(3-chloro-4-nitrophenyl)-2-(trifluoromethyl)-1,3-oxazolidine-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C2CN(c3ccc([N+](=O)[O-])c(Cl)c3)C(C(F)(F)F)O2)cc1 |
| InChI | InChI=1S/C19H16ClF3N4O5/c1-10(28)24-11-2-4-12(5-3-11)25-17(29)16-9-26(18(32-16)19(21,22)23)13-6-7-15(27(30)31)14(20)8-13/h2-8,16,18H,9H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | OOZAKVYJBTYGNH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|