C18H20ClF3N4O5 — CID 141470354
methyl 4-[4-(3-chloro-4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 141470354) has the molecular formula C18H20ClF3N4O5 and a molecular weight of 464.83 g/mol. Its IUPAC name is methyl 4-[4-(3-chloro-4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[4-(3-chloro-4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141470354 |
| Molecular Formula | C18H20ClF3N4O5 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | methyl 4-[4-(3-chloro-4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)C2CC(c3ccc([N+](=O)[O-])c(Cl)c3)C(C(F)(F)F)N2)CC1 |
| InChI | InChI=1S/C18H20ClF3N4O5/c1-31-17(28)25-6-4-24(5-7-25)16(27)13-9-11(15(23-13)18(20,21)22)10-2-3-14(26(29)30)12(19)8-10/h2-3,8,11,13,15,23H,4-7,9H2,1H3 |
| InChIKey | XLBZWANOTGYHGH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|