C16H15F3N4O4 — CID 52937322
methyl 4-[5-nitro-7-(trifluoromethyl)quinolin-3-yl]piperazine-1-carboxylate (PubChem CID 52937322) has the molecular formula C16H15F3N4O4 and a molecular weight of 384.31 g/mol. Its IUPAC name is methyl 4-[5-nitro-7-(trifluoromethyl)quinolin-3-yl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[5-nitro-7-(trifluoromethyl)quinolin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 52937322 |
| Molecular Formula | C16H15F3N4O4 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | methyl 4-[5-nitro-7-(trifluoromethyl)quinolin-3-yl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2cnc3cc(C(F)(F)F)cc([N+](=O)[O-])c3c2)CC1 |
| InChI | InChI=1S/C16H15F3N4O4/c1-27-15(24)22-4-2-21(3-5-22)11-8-12-13(20-9-11)6-10(16(17,18)19)7-14(12)23(25)26/h6-9H,2-5H2,1H3 |
| InChIKey | HIZGAIQABUEUIJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|