C11H5F6N3O4 — CID 22908766
methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate (PubChem CID 22908766) has the molecular formula C11H5F6N3O4 and a molecular weight of 357.17 g/mol. Its IUPAC name is methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate.
| Compound Name | methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 22908766 |
| Molecular Formula | C11H5F6N3O4 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate |
| SMILES | COC(=O)n1c(C(F)(F)F)nc2cc(C(F)(F)F)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C11H5F6N3O4/c1-24-9(21)19-7-5(18-8(19)11(15,16)17)2-4(10(12,13)14)3-6(7)20(22)23/h2-3H,1H3 |
| InChIKey | WMHAVXUJCMSTGN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|